86-16-8 Usage
General Description
4-(2,5-Diethoxy-4-nitrophenyl)morpholine is a chemical compound that belongs to the class of morpholine derivatives. It is a nitrophenyl-substituted morpholine, which is commonly used in pharmaceutical research and organic synthesis. 4-(2,5-Diethoxy-4-nitrophenyl)morpholine has two diethoxy groups and a nitro group attached to the phenyl ring, making it a versatile building block in the synthesis of various biologically active compounds. Its unique structure and properties make it a valuable intermediate in the production of pharmaceuticals, agrochemicals, and other organic materials. Additionally, its morpholine moiety contributes to its potential use as a bioactive compound or ligand in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 86-16-8 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 86-16:
(4*8)+(3*6)+(2*1)+(1*6)=58
58 % 10 = 8
So 86-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O5/c1-3-20-13-10-12(16(17)18)14(21-4-2)9-11(13)15-5-7-19-8-6-15/h9-10H,3-8H2,1-2H3