860626-80-8 Usage
Description
4-Fluoropyridine-3-boronic acid is an organic compound that features a fluorine atom at the 4-position and a boronic acid group at the 3-position of the pyridine ring. This unique structure endows it with versatile reactivity and potential applications in various chemical and pharmaceutical processes.
Uses
Used in Pharmaceutical Industry:
4-Fluoropyridine-3-boronic acid is used as a key intermediate in the synthesis of oxadiazolylphenylboronic acid derivatives and analogs. These compounds serve as potent fatty acid amide hydrolase (FAAH) inhibitors, which are of significant interest in the development of therapeutic agents for various disorders, including pain management and neurodegenerative diseases.
In the synthesis of these bioactive molecules, 4-Fluoropyridine-3-boronic acid plays a crucial role in forming the desired heterocyclic scaffolds, which are essential for the biological activity of the final products. Its reactivity and stability make it a valuable building block in medicinal chemistry and drug discovery efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 860626-80-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,0,6,2 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 860626-80:
(8*8)+(7*6)+(6*0)+(5*6)+(4*2)+(3*6)+(2*8)+(1*0)=178
178 % 10 = 8
So 860626-80-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BFNO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3,9-10H
860626-80-8Relevant articles and documents
INHIBITORS OF LOW MOLECULAR WEIGHT PROTEIN TYROSINE PHOSPHATASE (LMPTP) AND USES THEREOF
-
Paragraph 00284, (2019/07/20)
Protein tyrosine phosphatases (PTPs) are key regulators of metabolism and insulin signaling. As a negative regulator of insulin signaling, the low molecular weight protein tyrosine phosphatase (LMPTP) is a target for insulin resistance and related conditions. Described herein are compounds capable of modulating the level of activity of LMPTP, compositions, and methods of using these compounds and compositions.