868755-50-4 Usage
General Description
6-PIPERIDINOPYRIDINE-2-CARBOXYLIC ACID, also known as PIPERAZINECARBOXYLIC ACID, is a chemical compound with the molecular formula C11H15N3O2. It is a heterocyclic compound containing a piperidine ring and a pyridine ring, with a carboxylic acid group attached to the piperidine ring. This chemical is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and pharmaceutical compounds. It is known for its diverse range of biological activities and is often utilized as a precursor in the synthesis of medicinal drugs, agrochemicals, and other organic compounds. Additionally, it has been reported to have potential antifungal and antiviral properties, making it a valuable chemical in pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 868755-50-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,8,7,5 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 868755-50:
(8*8)+(7*6)+(6*8)+(5*7)+(4*5)+(3*5)+(2*5)+(1*0)=234
234 % 10 = 4
So 868755-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O2/c14-11(15)9-5-4-6-10(12-9)13-7-2-1-3-8-13/h4-6H,1-3,7-8H2,(H,14,15)
