870837-66-4 Usage
Description
2,4-Difluoro-3-methoxybenzaldehyde is an organic compound characterized by the presence of two fluorine atoms at the 2nd and 4th positions, a methoxy group at the 3rd position, and an aldehyde functional group. This unique molecular structure endows it with specific chemical properties, making it a versatile compound for various applications.
Uses
Used in Laboratory Applications:
2,4-Difluoro-3-methoxybenzaldehyde serves as a valuable laboratory reagent, utilized in a range of chemical analyses and synthesis processes. Its distinct chemical properties allow for precise manipulation and reaction control in experimental settings.
Used in Pharmaceutical Industry:
As an intermediate in pharmaceutical industries, 2,4-difluoro-3-methoxybenzaldehyde plays a crucial role in the synthesis of various drugs and medicinal compounds. Its unique structure contributes to the development of new pharmaceutical agents, potentially leading to advancements in treatment options and therapeutic efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 870837-66-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,8,3 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 870837-66:
(8*8)+(7*7)+(6*0)+(5*8)+(4*3)+(3*7)+(2*6)+(1*6)=204
204 % 10 = 4
So 870837-66-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6F2O2/c1-12-8-6(9)3-2-5(4-11)7(8)10/h2-4H,1H3
870837-66-4Relevant articles and documents
GEMINAL SUBSTITUTED QUINUCLIDINE AMIDE COMPOUNDS AS AGONISTS OF ALPHA-7 NICOTINIC ACETYLCHOLINE RECEPTORS
-
Paragraph 00573-00574, (2016/07/05)
The present invention relates to novel geminal substituted quinuclidine amide compounds, and pharmaceutical compositions of the same, that are suitable as agonists or partial agonists of α7- nAChR, and methods of preparing these compounds and compositions, and the use of these compounds and compositions in methods of maintaining, treating and/or improving cognitive function. In particular, methods of administering the compound or composition to a patient in need thereof, for example a patient with a cognitive deficiency and/or a desire to enhance cognitive function, that may derive a benefit therefrom.