871332-78-4 Usage
General Description
3-Nitro-5-(piperidin-1-ylcarbonyl)benzenaboronic acid is a chemical compound that contains a boronic acid group and a piperidine ring. It is commonly used in medicinal chemistry as a building block for the synthesis of biologically active molecules. 3-NITRO-5-(PIPERIDIN-1-YLCARBONYL)BENZENEBORONIC ACID has been found to exhibit inhibitory activity on the enzyme named tyrosine kinase, making it a potential candidate for the development of anti-cancer drugs. It has also shown promising antimicrobial and anti-inflammatory properties in preliminary studies. Additionally, its boronic acid functionality allows it to form stable complexes with certain biomolecules, making it a valuable tool for chemical biology research. Overall, 3-nitro-5-(piperidin-1-ylcarbonyl)benzenaboronic acid holds potential for a variety of therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-78-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 871332-78:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*7)+(1*8)=174
174 % 10 = 4
So 871332-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H15BN2O5/c16-12(14-4-2-1-3-5-14)9-6-10(13(17)18)8-11(7-9)15(19)20/h6-8,17-18H,1-5H2
