871332-79-5 Usage
General Description
3-(Ethylcarbamoyl)-5-nitrophenylboronic acid is a chemical compound that belongs to the class of organic boronic acids. It is used as a building block in the synthesis of pharmaceuticals and other organic compounds. 3-(ETHYLCARBAMOYL)-5-NITROPHENYLBORONIC ACID contains a boronic acid group, which is commonly used in Suzuki-Miyaura coupling reactions to form carbon-carbon bonds. Additionally, the presence of a nitro group and an ethylcarbamoyl group makes it a versatile reagent for the functionalization of aromatic compounds. Due to its potential use in medicinal chemistry and organic synthesis, 3-(ethylcarbamoyl)-5-nitrophenylboronic acid is a valuable compound in the field of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 871332-79-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,1,3,3 and 2 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 871332-79:
(8*8)+(7*7)+(6*1)+(5*3)+(4*3)+(3*2)+(2*7)+(1*9)=175
175 % 10 = 5
So 871332-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BN2O5/c1-2-11-9(13)6-3-7(10(14)15)5-8(4-6)12(16)17/h3-5,14-15H,2H2,1H3,(H,11,13)
