87141-66-0 Usage
Description
CYCLOPROPYL 2-(4-METHOXYPHENYL)ETHYL KETONE is a chemical compound characterized by a cyclopropyl functional group and a 4-methoxyphenyl substituent attached to a ketone. It is known for its unique structure and reactivity, which makes it a valuable building block in organic synthesis and pharmaceutical manufacturing. CYCLOPROPYL 2-(4-METHOXYPHENYL)ETHYL KETONE holds potential for the development of new drugs and materials, offering a wide range of applications due to its specific properties.
Uses
Used in Organic Synthesis:
CYCLOPROPYL 2-(4-METHOXYPHENYL)ETHYL KETONE is used as a building block in organic synthesis for creating complex molecules with specific properties. Its cyclopropyl functional group and 4-methoxyphenyl substituent contribute to the formation of diverse chemical structures, making it a versatile component in the synthesis of various organic compounds.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, CYCLOPROPYL 2-(4-METHOXYPHENYL)ETHYL KETONE is utilized as a key intermediate in the production of drugs. Its unique structure allows for the development of molecules with targeted therapeutic effects, potentially leading to the creation of new and improved medications.
Used in Drug Development:
CYCLOPROPYL 2-(4-METHOXYPHENYL)ETHYL KETONE may have potential applications in the development of new drugs, thanks to its reactivity and the possibility of forming complex molecular structures. Researchers can explore its properties to design and synthesize novel pharmaceutical agents with specific therapeutic targets and improved efficacy.
Check Digit Verification of cas no
The CAS Registry Mumber 87141-66-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,1,4 and 1 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 87141-66:
(7*8)+(6*7)+(5*1)+(4*4)+(3*1)+(2*6)+(1*6)=140
140 % 10 = 0
So 87141-66-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H16O2/c1-15-12-7-2-10(3-8-12)4-9-13(14)11-5-6-11/h2-3,7-8,11H,4-6,9H2,1H3
87141-66-0Relevant articles and documents
3-Methylcyclohex-2-enone Derivatives as Initiators of Cyclisation. Part 4. Some Bicyclisations
Amupitan, Joseph A.,Beddoes, Roy L.,Mills, Owen S.,Sutherland, James K.
, p. 759 - 764 (2007/10/02)
Hydrochrysene and hydrophenanthrene derivatives (8)-(14) have been prepared by cyclisation of 2-substituted 3-methylcyclohexen-2-ones and the derived 2,3-epoxides.Cyclisation of the epoxides does not give preparatively useful yields of bicyclised compound
