87254-95-3 Usage
Description
(5R)-2,5,6,7-tetrahydro-1,4-thiazepine-3,5-dicarboxylic acid is a bicyclic chemical compound belonging to the thiazepine class of organic compounds. It features a seven-membered thiazepine ring with nitrogen and sulfur atoms, as well as a tetrahydro-1,4-thiazepine-3,5-dicarboxylic acid skeleton. This rare amino acid is found in some natural products and serves as a valuable building block in the synthesis of other compounds. Its unique structure and properties lend it potential pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
(5R)-2,5,6,7-tetrahydro-1,4-thiazepine-3,5-dicarboxylic acid is used as a building block for the synthesis of pharmaceutical compounds due to its unique structure and properties. Its incorporation into drug molecules can potentially enhance their therapeutic effects and target specific biological pathways.
Used in Research Applications:
In research settings, (5R)-2,5,6,7-tetrahydro-1,4-thiazepine-3,5-dicarboxylic acid is utilized as a key component in the development of novel compounds with potential applications in various fields, including medicine, agriculture, and materials science. Its versatility and unique characteristics make it a promising candidate for creating innovative and effective solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 87254-95-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,2,5 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 87254-95:
(7*8)+(6*7)+(5*2)+(4*5)+(3*4)+(2*9)+(1*5)=163
163 % 10 = 3
So 87254-95-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO4S/c9-6(10)4-1-2-13-3-5(8-4)7(11)12/h4H,1-3H2,(H,9,10)(H,11,12)/t4-/m1/s1
