87270-38-0 Usage
Description
(2R)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]acetyl]amino]-3-methylsulfanyl-propanoic acid is a complex organic molecule with a unique structure. It contains a methylsulfanyl group, a benzoyl group, and an indol-3-yl group, among others. (2R)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]acetyl]a mino]-3-methylsulfanyl-propanoic acid has potential pharmaceutical applications, as it may interact with biological systems due to its acetyl amino and methylsulfanyl functional groups. The presence of a chlorobenzoyl and methoxy group suggests that it could have specific pharmacological and bioactivity properties.
Uses
Used in Pharmaceutical Industry:
(2R)-2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-indol-3-yl]acetyl]amino]-3-methylsulfanyl-propanoic acid is used as a pharmaceutical compound for its potential interaction with biological systems. Its acetyl amino and methylsulfanyl functional groups may contribute to its bioactivity and pharmacological properties, making it a promising candidate for further research and development in the pharmaceutical field. Further studies on its synthesis, properties, and potential uses are warranted to fully understand its applications and benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 87270-38-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,2,7 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 87270-38:
(7*8)+(6*7)+(5*2)+(4*7)+(3*0)+(2*3)+(1*8)=150
150 % 10 = 0
So 87270-38-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H23ClN2O5S/c1-13-17(11-21(27)25-19(12-32-3)23(29)30)18-10-16(31-2)8-9-20(18)26(13)22(28)14-4-6-15(24)7-5-14/h4-10,19H,11-12H2,1-3H3,(H,25,27)(H,29,30)/t19-/m0/s1