874219-32-6 Usage
General Description
4-Fluoro-3-(N-propylcarbamoyl)benzenaboronic acid is a chemical compound with the molecular formula C11H14BFNO4. It is a boronic acid derivative that contains a fluorine atom and a propylcarbamoyl group attached to a benzene ring. 4-FLUORO-3-(N-PROPYLCARBAMOYL)BENZENEBORONIC ACID has potential applications in organic synthesis, particularly in the field of medicinal chemistry and drug development. Boronic acids are known for their ability to form reversible covalent bonds with diols, which makes them useful in the design of enzyme inhibitors and drug delivery systems. The incorporation of a fluorine atom can also enhance the chemical and physical properties of the molecule, making it a valuable building block for the synthesis of pharmaceuticals and biologically active compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 874219-32-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,1 and 9 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 874219-32:
(8*8)+(7*7)+(6*4)+(5*2)+(4*1)+(3*9)+(2*3)+(1*2)=186
186 % 10 = 6
So 874219-32-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BFNO3/c1-2-5-13-10(14)8-6-7(11(15)16)3-4-9(8)12/h3-4,6,15-16H,2,5H2,1H3,(H,13,14)
