874289-09-5 Usage
General Description
3-Fluoro-4-(pyrrolidine-1-carbonyl)phenylboronic Acid is a complex synthetic chemical compound with several uses in the field of chemistry, specifically in the processes of cross-coupling reactions. It has the chemical formula C11H13BFNO3, indicating that it is composed of carbon, hydrogen, boron, fluorine, nitrogen, and oxygen atoms. The boronic acid in this compound enables it to function as a reagent, which in chemistry means it is used to cause or accelerate a chemical reaction. It has a molar mass of 221.035 g/mol. Since this is a specialized compound, it is primarily used in research and industrial applications rather than commercially or domestically.
Check Digit Verification of cas no
The CAS Registry Mumber 874289-09-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,4,2,8 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 874289-09:
(8*8)+(7*7)+(6*4)+(5*2)+(4*8)+(3*9)+(2*0)+(1*9)=215
215 % 10 = 5
So 874289-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H13BFNO3/c13-10-7-8(12(16)17)3-4-9(10)11(15)14-5-1-2-6-14/h3-4,7,16-17H,1-2,5-6H2
