87540-17-8 Usage
Chemical structure
The compound has a phthalazine ring fused to a triazole ring, with a 3-(3,5-dibromo-2-ethoxyphenyl) group and a 6-(1-pyrrolidinyl) group as substituents.
Molecular weight
The molecular weight of the compound is approximately 464.16 g/mol.
Functional groups
The compound contains several functional groups, including a phthalazine ring, a triazole ring, bromo substituents, an ethoxyphenyl group, and a pyrrolidinyl group.
Potential applications
Due to its unique structure and potential biological activities, the compound may have applications in pharmaceutical research and drug development.
Further research
Additional studies are needed to fully understand the properties and potential uses of this chemical compound.
Solubility
The solubility of the compound in various solvents is not mentioned in the provided material, but it may vary depending on the functional groups and molecular structure.
Stability
The stability of the compound under different conditions (e.g., temperature, pH, light exposure) is not provided in the material, but it may be influenced by the presence of reactive functional groups.
Reactivity
The reactivity of the compound with other chemicals or biological molecules is not specified in the material, but it may be influenced by the presence of the various functional groups.
Synthesis
The synthesis method for the compound is not provided in the material, but it may involve the formation of the phthalazine and triazole rings, followed by the introduction of the substituents.
Check Digit Verification of cas no
The CAS Registry Mumber 87540-17-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,5,4 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 87540-17:
(7*8)+(6*7)+(5*5)+(4*4)+(3*0)+(2*1)+(1*7)=148
148 % 10 = 8
So 87540-17-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H19Br2N5O/c1-2-29-18-16(11-13(22)12-17(18)23)20-25-24-19-14-7-3-4-8-15(14)21(26-28(19)20)27-9-5-6-10-27/h3-4,7-8,11-12H,2,5-6,9-10H2,1H3
87540-17-8Relevant articles and documents
6-(Alkylamino)-3-aryl-1,2,4-triazolophthalazines. A New Class of Benzodiazepine Receptor Ligands
Tarzia, Giorgio,Occelli, Emilio,Toja, Emilio,Barone, Domenico,Corsico, Nerina,et al.
, p. 1115 - 1123 (2007/10/02)
Some 6-(alkylamino)-3-aryl-1,2,4-triazolophthalazines have been shown to displace diazepam from rat brain specific binding sites, in vitro, with Ki (nM) values comparable to those of reference benzodiazepines and to have anticonvulsant (