876379-76-9 Usage
General Description
6-fluoroH-pyrazolo[1,5-a]pyridine-2-carboxylic acid is a chemical compound with a complex structure containing a pyrazolo-pyridine core and a carboxylic acid functional group. It is a heterocyclic compound with a fluorine atom attached to the 6th position of the pyrazole ring. 6-fluoroH-pyrazolo[1,5-a]pyridine-2-carboxylic acid is used in pharmaceutical research and drug development due to its potential biological activities. Specifically, its structure suggests that it may have potential as an anti-inflammatory or anti-cancer agent, although further research is needed to determine its specific pharmacological properties. Additionally, its unique structure makes it a valuable building block for creating novel compounds with potential medicinal properties.
Check Digit Verification of cas no
The CAS Registry Mumber 876379-76-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,3,7 and 9 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 876379-76:
(8*8)+(7*7)+(6*6)+(5*3)+(4*7)+(3*9)+(2*7)+(1*6)=239
239 % 10 = 9
So 876379-76-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H5FN2O2/c9-5-1-2-6-3-7(8(12)13)10-11(6)4-5/h1-4H,(H,12,13)
876379-76-9Relevant articles and documents
INDOLIZINE CARBOXAMIDES AND THE AZA AND DIAZA DERIVATIVES THEREOF
-
Page/Page column 48, (2010/10/19)
The invention relates to neuroreceptor-active carboxamide-substituted indolizine derivatives of general formula (I) wherein X represents a group of general formula (X1).
