876379-80-5 Usage
General Description
3-chloroH-pyrazolo[1,5-a]pyridine-5-carboxylic acid is a chemical compound with the molecular formula C8H5ClN4O2. It belongs to the class of pyrazolo[1,5-a]pyridine carboxylic acids and contains a chlorine atom attached to a pyrazole ring. 3-chloroH-pyrazolo[1,5-a]pyridine-5-carboxylic acid has potential applications in medicinal chemistry, specifically in the development of drugs targeting certain enzymes or receptors. Its structure and properties make it a valuable starting material for the synthesis of bioactive molecules with potential pharmaceutical uses. Further research and investigation into the properties and potential applications of 3-chloroH-pyrazolo[1,5-a]pyridine-5-carboxylic acid are warranted to fully understand its role in drug development and other chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 876379-80-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,6,3,7 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 876379-80:
(8*8)+(7*7)+(6*6)+(5*3)+(4*7)+(3*9)+(2*8)+(1*0)=235
235 % 10 = 5
So 876379-80-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClN2O2/c9-6-4-10-11-2-1-5(8(12)13)3-7(6)11/h1-4H,(H,12,13)
876379-80-5Relevant articles and documents
INDOLIZINE CARBOXAMIDES AND THE AZA AND DIAZA DERIVATIVES THEREOF
-
Page/Page column 49, (2010/10/19)
The invention relates to neuroreceptor-active carboxamide-substituted indolizine derivatives of general formula (I) wherein X represents a group of general formula (X1).
