88206-46-6 Usage
Description
Notopterol, extracted from Notopterygium Incisum, is a bioactive compound with antiproliferative and apoptotic properties. It is known for its analgesic effects, making it a potential candidate for various pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
Notopterol is used as an antiproliferative agent for its ability to inhibit the growth of cancer cells. It is particularly effective against various types of cancer due to its apoptotic activity, which induces programmed cell death in malignant cells.
Notopterol is also used as an analgesic for its pain-relieving properties. It can be employed in the development of medications aimed at alleviating pain and discomfort associated with various conditions, such as headaches, muscle aches, and joint pain.
In addition to its antiproliferative and analgesic applications, Notopterol may also be utilized in other therapeutic areas, given its potential to modulate various biological pathways and processes. Further research and development are necessary to fully explore and harness its potential in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 88206-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,2,0 and 6 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 88206-46:
(7*8)+(6*8)+(5*2)+(4*0)+(3*6)+(2*4)+(1*6)=146
146 % 10 = 6
So 88206-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H22O5/c1-13(2)10-15(22)11-14(3)6-8-25-21-16-4-5-20(23)26-19(16)12-18-17(21)7-9-24-18/h4-7,9-10,12,15,22H,8,11H2,1-3H3/b14-6+