88399-23-9 Usage
Molecular structure
The compound has a benzopyrylium core with multiple glucopyranosyl and hydroxyphenyl groups attached to it. It also contains a chloride ion.
Functional groups
The compound has both hydroxyl and carboxyacetyl functional groups, which contribute to its chemical properties and potential applications.
Polyphenolic compound
The presence of multiple hydroxyphenyl groups makes it a polyphenolic compound, which is known for its antioxidant properties.
Potential antioxidant properties
Due to its polyphenolic nature, the compound may have antioxidant properties that can help protect cells from oxidative damage.
Pharmaceutical potential
The complex structure and functional groups of the compound suggest potential therapeutic applications in the pharmaceutical industry.
Need for further research
While the structure of the compound indicates potential applications, more research is needed to fully understand its biological activity and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 88399-23-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,3,9 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 88399-23:
(7*8)+(6*8)+(5*3)+(4*9)+(3*9)+(2*2)+(1*3)=189
189 % 10 = 9
So 88399-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C39H38O22/c40-17-4-1-15(2-5-17)3-6-28(46)55-13-25-31(49)34(52)36(54)39(61-25)59-24-11-19-22(57-37(24)16-7-20(42)30(48)21(43)8-16)9-18(41)10-23(19)58-38-35(53)33(51)32(50)26(60-38)14-56-29(47)12-27(44)45/h1-11,25-26,31-36,38-39,49-54H,12-14H2,(H5-,40,41,42,43,44,45,46,48)/p+1/t25-,26-,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1