884495-01-6 Usage
General Description
4-Bromo-5-fluoro-2(1H)-pyridinone is a synthetic chemical compound that belongs to the organohalogen compound class, exhibiting not one, but two halogens within its structure, bromine (Br) and fluorine (F). Its molecular formula is C5H2BrFNO, signifying the inclusion of carbon, hydrogen, bromine, fluorine, nitrogen, and oxygen atoms. This pyridinone compound, featuring a six-membered aromatic ring with a nitrogen atom and a carbonyl group, is often used in organic chemistry as a building block or reagent for the synthesis of more complex molecules, especially pharmaceutically active compounds. Its physico-chemical properties, like solubility, boiling and melting point, would vary depending on conditions including temperature and pressure. Handling and storage of 4-Bromo-5-fluoro-2(1H)-pyridinone require adherence to safety regulations due to possible risks and hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 884495-01-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 884495-01:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*5)+(2*0)+(1*1)=216
216 % 10 = 6
So 884495-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrFNO/c6-3-1-5(9)8-2-4(3)7/h1-2H,(H,8,9)
