884507-56-6 Usage
Description
1-(3-IODOBENZYL)-1H-PYRAZOLE, with the molecular formula C10H9IN2, is a chemical compound belonging to the class of pyrazoles, which are five-membered aromatic heterocyclic compounds. This specific compound features an iodine atom and a benzyl group attached to a pyrazole ring, making it a valuable building block in chemical research and drug discovery. Its unique structure and reactivity contribute to its significance in the development of pharmaceuticals and agrochemicals. Furthermore, it serves as a reagent in organic synthesis for introducing the 3-iodobenzyl group into other molecules, showcasing its versatility in the field of chemistry and chemical biology.
Uses
Used in Chemical Research and Drug Discovery:
1-(3-IODOBENZYL)-1H-PYRAZOLE is used as a building block for the synthesis of various organic compounds, playing a crucial role in the development of new pharmaceuticals and agrochemicals. Its unique structure and reactivity make it an essential component in the creation of novel molecules with potential therapeutic and pesticidal properties.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(3-IODOBENZYL)-1H-PYRAZOLE is employed as a reagent to introduce the 3-iodobenzyl group into other molecules. This application is vital for the synthesis of complex organic compounds and contributes to the advancement of chemical research and the development of new materials and products.
Used in Pharmaceutical Development:
1-(3-IODOBENZYL)-1H-PYRAZOLE is used as a key component in the development of pharmaceuticals, particularly due to its potential to enhance the properties of existing drugs or create new ones with improved efficacy and reduced side effects. Its unique structure allows for the design of targeted therapies and the exploration of novel drug candidates.
Used in Agrochemical Development:
In the agrochemical industry, 1-(3-IODOBENZYL)-1H-PYRAZOLE is utilized as a building block for the synthesis of new pesticides and other agrochemicals. Its incorporation into these compounds can lead to the development of more effective and environmentally friendly products for agricultural use.
Overall, 1-(3-IODOBENZYL)-1H-PYRAZOLE is a versatile and important chemical compound with a wide range of applications in various industries, including pharmaceuticals, agrochemicals, and organic synthesis. Its unique structure and reactivity make it a valuable asset in the ongoing pursuit of scientific advancements and the development of innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 884507-56-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,5,0 and 7 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 884507-56:
(8*8)+(7*8)+(6*4)+(5*5)+(4*0)+(3*7)+(2*5)+(1*6)=206
206 % 10 = 6
So 884507-56-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H9IN2/c11-10-4-1-3-9(7-10)8-13-6-2-5-12-13/h1-7H,8H2
