885267-40-3 Usage
General Description
2-Bromo-5-chloro-4-methylpyridine is a chemical compound that belongs to the pyridine family, which are widely used in the production of pharmaceuticals, agrochemicals, and electronic materials. It is a yellowish to brown solid with a molecular formula of C6H5BrClN. 2-BROMO-5-CHLORO-4-METHYLPYRIDINE is primarily used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, such as fungicides and herbicides. It is also used as a building block in the production of organic compounds and as a reagent in chemical reactions. Additionally, 2-Bromo-5-chloro-4-methylpyridine is known to have potential applications in the field of organic synthesis and medicinal chemistry due to its unique chemical properties and structure.
Check Digit Verification of cas no
The CAS Registry Mumber 885267-40-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,6 and 7 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 885267-40:
(8*8)+(7*8)+(6*5)+(5*2)+(4*6)+(3*7)+(2*4)+(1*0)=213
213 % 10 = 3
So 885267-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrClN/c1-4-2-6(7)9-3-5(4)8/h2-3H,1H3