885518-94-5 Usage
General Description
5-Hydroxy-1H-Indazole-3-Carboxylic Acid is a chemical compound that falls under the category of indazoles. Indazoles are organic compounds that contain a nitrogen atom in a pyrazole ring fused to a benzene ring. Its classification as "5-Hydroxy" indicates the presence of a hydroxyl group at the 5th carbon in the indazole ring, while the "3-Carboxylic Acid" refers to a carboxylic acid group at the 3rd carbon. Its precise properties, including stability, toxicity and potential uses, depend largely on various conditions and require intensive scientific investigation to determine. Due to its complex structure, this compound could potentially be relevant in various fields such as medicine, biology, or materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 885518-94-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,5,1 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 885518-94:
(8*8)+(7*8)+(6*5)+(5*5)+(4*1)+(3*8)+(2*9)+(1*4)=225
225 % 10 = 5
So 885518-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O3/c11-4-1-2-6-5(3-4)7(8(12)13)10-9-6/h1-3,11H,(H,9,10)(H,12,13)
