88599-48-8 Usage
Description
(2-methylphenyl) 2-carbamoyloxy-5-chloro-benzoate is a benzoic acid derivative featuring a carbamoyloxy group, a methylphenyl group, and a chlorine atom. This chemical compound serves as a valuable intermediate in the synthesis of pharmaceuticals and organic compounds, with potential applications in medicinal chemistry and the development of new drugs and therapeutic agents. Due to its potential hazards if mishandled, careful management is essential.
Uses
Used in Pharmaceutical Industry:
(2-methylphenyl) 2-carbamoyloxy-5-chloro-benzoate is used as a chemical intermediate for the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows it to be a key component in the development of new drugs and therapeutic agents, contributing to advancements in medicinal chemistry.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (2-methylphenyl) 2-carbamoyloxy-5-chloro-benzoate is utilized for its potential to contribute to the discovery and design of novel drug candidates. Its specific functional groups and structural features make it a promising compound for exploring new therapeutic approaches and improving existing treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 88599-48-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,5,9 and 9 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 88599-48:
(7*8)+(6*8)+(5*5)+(4*9)+(3*9)+(2*4)+(1*8)=208
208 % 10 = 8
So 88599-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H12ClNO4/c1-9-4-2-3-5-12(9)20-14(18)11-8-10(16)6-7-13(11)21-15(17)19/h2-8H,1H3,(H2,17,19)
