886363-04-8 Usage
Description
4-BENZYLOXY-2-PYRROLIDIN-1-YLMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER is a complex chemical compound featuring a benzyl ester derived from benzoic acid and a pyrrolidine ring with a benzyloxy group attached. 4-BENZYLOXY-2-PYRROLIDIN-1-YLMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER is recognized for its unique structure and functional groups, which make it a valuable building block in the synthesis of pharmaceuticals and organic compounds.
Uses
Used in Pharmaceutical Industry:
4-BENZYLOXY-2-PYRROLIDIN-1-YLMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER is used as a key intermediate in the synthesis of various pharmaceuticals for its potential to contribute to the development of new drugs. Its unique molecular structure allows it to be a versatile component in medicinal chemistry.
Used in Organic Chemistry:
In the field of organic chemistry, 4-BENZYLOXY-2-PYRROLIDIN-1-YLMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER is utilized as a building block for the creation of diverse organic compounds, taking advantage of its reactive functional groups and complex structure.
Used in Drug Discovery:
4-BENZYLOXY-2-PYRROLIDIN-1-YLMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER is employed in drug discovery processes due to its potential biological activity and pharmacological properties. Its unique features make it a promising candidate for further research and development in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 886363-04-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 3 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 886363-04:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*3)+(2*0)+(1*4)=208
208 % 10 = 8
So 886363-04-8 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N2O3/c27-24(29-19-21-11-5-2-6-12-21)26-17-23(28-18-20-9-3-1-4-10-20)15-22(26)16-25-13-7-8-14-25/h1-6,9-12,22-23H,7-8,13-19H2