886363-68-4 Usage
General Description
3-(3,4-Dichloro-phenyl)-tetrahydro-pyran-2-one is a chemical compound with the molecular formula C10H9Cl2O2. It is a tetrahydropyran derivative with a substitution of a dichloro-phenyl group. 3-(3,4-DICHLORO-PHENYL)-TETRAHYDRO-PYRAN-2-ONE is a white solid at room temperature and is known for its potential use in medicinal and pharmaceutical applications due to its unique chemical structure. It has been studied for its potential as an antifungal and antibacterial agent, and it has also been explored for its potential as a starting material for the synthesis of other biologically active compounds. The compound's precise properties and potential uses are subject to ongoing research and study in the field of organic chemistry and pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 886363-68-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 3 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 886363-68:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*3)+(2*6)+(1*8)=224
224 % 10 = 4
So 886363-68-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H10Cl2O2/c12-9-4-3-7(6-10(9)13)8-2-1-5-15-11(8)14/h3-4,6,8H,1-2,5H2
