886365-92-0 Usage
Description
N-(4-CYCLOHEXYLPHENYL)-4-ISOPROPYLBENZENAMINE, also known as (4-Cyclohexyl-phenyl)-(4-isopropyl-phenyl)-amine, is a chemical compound with the CAS number 886365-92-0. It is characterized by its unique molecular structure, featuring a cyclohexylphenyl group connected to an isopropylbenzenamine group. N-(4-CYCLOHEXYLPHENYL)-4-ISOPROPYLBENZENAMINE plays a significant role in the development of organic electroluminescent devices due to its specific properties.
Uses
Used in Organic Electroluminescent Devices Industry:
N-(4-CYCLOHEXYLPHENYL)-4-ISOPROPYLBENZENAMINE is used as a reagent for the development and production of organic electroluminescent devices. Its unique molecular structure allows it to contribute to the efficient functioning and performance of these devices, making it a valuable component in this industry.
Check Digit Verification of cas no
The CAS Registry Mumber 886365-92-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 886365-92:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*5)+(2*9)+(1*2)=230
230 % 10 = 0
So 886365-92-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H27N/c1-16(2)17-8-12-20(13-9-17)22-21-14-10-19(11-15-21)18-6-4-3-5-7-18/h8-16,18,22H,3-7H2,1-2H3