887589-43-7 Usage
General Description
6-bromo-4-chloro-2-quinolinecarboxylic acid is a chemical compound with a molecular formula C10H5BrClNO2. It is a heterocyclic compound containing both bromine and chlorine atoms, as well as a carboxylic acid group. 6-bromo-4-chloro-2-quinolinecarboxylic acid is commonly used in medicinal chemistry as a building block for the synthesis of various pharmaceuticals and biologically active molecules. It has been studied for its potential antitumor and antimicrobial properties. Additionally, it is a valuable substrate for various chemical reactions, including cross-coupling reactions and the formation of heterocyclic compounds. The chemical properties and reactivity of 6-bromo-4-chloro-2-quinolinecarboxylic acid make it a versatile and important intermediate in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 887589-43-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,8 and 9 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 887589-43:
(8*8)+(7*8)+(6*7)+(5*5)+(4*8)+(3*9)+(2*4)+(1*3)=257
257 % 10 = 7
So 887589-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H5BrClNO2/c11-5-1-2-8-6(3-5)7(12)4-9(13-8)10(14)15/h1-4H,(H,14,15)
