889-10-1 Usage
General Description
2-(4-METHOXYBENZYLIDENE)SUCCINIC ACID is a chemical compound that belongs to the class of benzylidene succinic acids. It is a relatively simple organic compound with a molecular formula of C13H14O5. 2-(4-METHOXYBENZYLIDENE)SUCCINIC ACID is often used in the pharmaceutical industry for its potential medicinal properties, and it may have applications in the development of new drugs. Additionally, it may also have potential uses in other areas such as organic synthesis and material science. Overall, 2-(4-METHOXYBENZYLIDENE)SUCCINIC ACID is a versatile chemical compound with various potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 889-10-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,8 and 9 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 889-10:
(5*8)+(4*8)+(3*9)+(2*1)+(1*0)=101
101 % 10 = 1
So 889-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H12O5/c1-17-10-4-2-8(3-5-10)6-9(12(15)16)7-11(13)14/h2-6H,7H2,1H3,(H,13,14)(H,15,16)
