889953-03-1 Usage
General Description
2-(1-(Benzyloxycarbonyl)pyrrolidin-2-yl)acetic acid, also known as Boc-proline, is a compound used in organic chemistry for the synthesis of peptide molecules. It is commonly used as a protecting group for the amino group in peptide synthesis, allowing for selective deprotection of the group under specific conditions. Boc-proline is a white solid that is sparingly soluble in water and commonly used in the pharmaceutical industry for the production of various drugs. Its chemical structure consists of a proline molecule with a benzyloxycarbonyl (Boc) protecting group attached to the nitrogen atom, making it a valuable tool in the field of organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 889953-03-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,9,9,5 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 889953-03:
(8*8)+(7*8)+(6*9)+(5*9)+(4*5)+(3*3)+(2*0)+(1*3)=251
251 % 10 = 1
So 889953-03-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO4/c16-13(17)9-12-7-4-8-15(12)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,16,17)
