89079-62-9 Usage
General Description
4-Methyl-2-(methylthio)-5-pyrimidinecarbonitrile is a chemical compound with the molecular formula C7H7N3S. It is a pyrimidine derivative that is often used in the synthesis of pharmaceuticals and agrochemicals. 4-Methyl-2-(methylthio)-5-pyrimidinecarbonitrile has potential applications in the field of medicinal chemistry as it can act as a building block for the synthesis of various biologically active compounds. Additionally, the presence of the methylthio group in the molecule adds to its reactivity and potential pharmaceutical properties. Due to its unique structure and potential pharmacological properties, 4-Methyl-2-(methylthio)-5-pyrimidinecarbonitrile is an important compound in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 89079-62-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,0,7 and 9 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89079-62:
(7*8)+(6*9)+(5*0)+(4*7)+(3*9)+(2*6)+(1*2)=179
179 % 10 = 9
So 89079-62-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3S/c1-5-6(3-8)4-9-7(10-5)11-2/h4H,1-2H3
89079-62-9Relevant articles and documents
Introduction of Carbon Substituents into Pyrimidines by Grignard Reagents
Rise, Frode,Ongstad, Leif,Gacek, Michel,Undheim, Kjell
, p. 613 - 616 (2007/10/02)
Alkyl- and arylmagnesium halides selectively form 1:1-adducts with the heterocyclic ring in substituted 5-cyanopyrimidines.Dehydrogenation gives the corresponding alkyl or aryl substituted pyrimidine.
