89169-88-0 Usage
Chemical compound
A complex molecule with a unique structure.
Synthesis
Formed by the reaction of 1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazole-4-carbaldehyde with hydroxylamine.
Functional group
Contains an oxime functional group.
Potential applications
Organic synthesis, pharmaceuticals, and agrochemicals.
Structural features
Unique structural features contribute to its reactivity and potential applications.
Biological activity
May exhibit biological activity, making it of interest for further research.
Medicinal chemistry
Could be of interest for research in medicinal chemistry and drug development.
Additional studies
More research is needed to fully characterize its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 89169-88-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,1,6 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 89169-88:
(7*8)+(6*9)+(5*1)+(4*6)+(3*9)+(2*8)+(1*8)=190
190 % 10 = 0
So 89169-88-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3O2/c1-9-11(8-13-17)12(16)15(14(9)2)10-6-4-3-5-7-10/h3-8,17H,1-2H3