89284-16-2 Usage
General Description
2,5-Dibromo-3-methylfuran is a chemical compound with the molecular formula C6H5Br2O and a molar mass of 248.91 g/mol. It is a brominated derivative of furan, a heterocyclic compound with a five-membered ring containing one oxygen atom. The 2,5-dibromo-3-methylfuran molecule consists of a furan ring with two bromine atoms and a methyl group attached. 2,5-Dibromo-3-methylfuran is primarily used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is also employed as a building block in organic chemistry research and for the development of new materials. Additionally, 2,5-dibromo-3-methylfuran has potential applications in the field of medicine and pharmacology due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 89284-16-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,2,8 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 89284-16:
(7*8)+(6*9)+(5*2)+(4*8)+(3*4)+(2*1)+(1*6)=172
172 % 10 = 2
So 89284-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Br2O/c1-3-2-4(6)8-5(3)7/h2H,1H3
