89331-01-1 Usage
Description
5-Nitro-2-tetralone is a heterocyclic organic compound with a tetralone core structure, featuring a nitro group at the 5th position and a ketone group at the 2nd position. It is a yellow crystalline solid and is known for its chemical reactivity and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
5-Nitro-2-tetralone is used as a building block for the synthesis of various pharmaceutical compounds, including Benz[cd]indoles. These compounds have potential applications in the development of new drugs with diverse therapeutic properties.
Used in Chemical Research:
5-Nitro-2-tetralone is used as a research compound in the field of organic chemistry, particularly for studying the reactivity and properties of heterocyclic compounds. It can be employed in various chemical reactions to explore its potential as a precursor for the synthesis of other complex organic molecules.
Used in Material Science:
5-Nitro-2-tetralone may have potential applications in the development of new materials, such as organic semiconductors or functional polymers, due to its unique chemical structure and properties. Further research is needed to explore its potential in this field.
Check Digit Verification of cas no
The CAS Registry Mumber 89331-01-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,3,3 and 1 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 89331-01:
(7*8)+(6*9)+(5*3)+(4*3)+(3*1)+(2*0)+(1*1)=141
141 % 10 = 1
So 89331-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO3/c12-8-4-5-9-7(6-8)2-1-3-10(9)11(13)14/h1-3H,4-6H2
89331-01-1Relevant articles and documents
BENZINDOLES - I. THE USE OF TERT-BUTOXY-BIS(DIMETHYLAMINO)METHANE AS CONDENSATION REAGENT.
Haefliger, W.,Knecht, H.
, p. 285 - 288 (2007/10/02)
A simple and efficient route to benzindoles is the reaction of nitrotetralins with Bredereck's reagent and reduction of the condensation product to the corresponding annelated indole.