89418-10-0 Usage
General Description
Pyrazolo[1,5-a]pyrimidin-5(4H)-one, 7-amino- (9CI) is a chemical compound with the molecular formula C7H6N4O. It is a heterocyclic compound with a pyrazole fused to a pyrimidine ring, and a carbonyl group at position 5. The compound exists in the tautomeric form and is commonly used for research purposes as a building block for the synthesis of various organic compounds. It may also have potential pharmaceutical applications due to its structural features and ability to interact with biological systems. However, further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 89418-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,1 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89418-10:
(7*8)+(6*9)+(5*4)+(4*1)+(3*8)+(2*1)+(1*0)=160
160 % 10 = 0
So 89418-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O/c7-4-3-6(11)9-5-1-2-8-10(4)5/h1-3H,7H2,(H,9,11)