898289-59-3 Usage
General Description
3-(2-Methyl-1H-imidazol-1-yl)benzoic acid is a chemical compound with the molecular formula C11H10N2O2. It is a derivative of benzoic acid and contains a methylated imidazole ring. 3-(2-Methyl-1H-imidazol-1-yl)benzoic acid has potential pharmaceutical applications, particularly in the field of medicinal chemistry. It is known to possess anti-inflammatory and analgesic properties, making it a possible candidate for the development of new drugs for the treatment of pain and inflammation-related conditions. Additionally, it may also have antimicrobial and antifungal properties, suggesting potential use in the development of antimicrobial agents. Further research into the biological and pharmacological activities of 3-(2-Methyl-1H-imidazol-1-yl)benzoic acid may reveal its full potential for various medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 898289-59-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,2,8 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 898289-59:
(8*8)+(7*9)+(6*8)+(5*2)+(4*8)+(3*9)+(2*5)+(1*9)=263
263 % 10 = 3
So 898289-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-8-12-5-6-13(8)10-4-2-3-9(7-10)11(14)15/h2-7H,1H3,(H,14,15)