89856-17-7 Usage
Explanation
The chemical compound 1-Piperazinecarboxamide, N,4-dimethyl has a molecular formula of C8H16N4O, indicating the number of carbon, hydrogen, nitrogen, and oxygen atoms in the molecule.
2. Derivative of piperazine
Explanation
1-Piperazinecarboxamide, N,4-dimethyl is a derivative of piperazine, which is a heterocyclic amine used in the production of pharmaceuticals and pesticides.
3. Anti-inflammatory properties
Explanation
The compound is known to possess anti-inflammatory properties, which can help reduce swelling, pain, and redness in the body.
4. Analgesic properties
Explanation
1-Piperazinecarboxamide, N,4-dimethyl has analgesic properties, meaning it can help alleviate pain in the body.
5. Antitussive properties
Explanation
The compound exhibits antitussive properties, which can help suppress or reduce coughing.
6. Potential candidate for new drugs
Explanation
Due to its various properties, such as anti-inflammatory, analgesic, and antitussive, 1-Piperazinecarboxamide, N,4-dimethyl is a potential candidate for the development of new drugs.
7. Context-dependent uses and effects
Explanation
The specific uses and effects of 1-Piperazinecarboxamide, N,4-dimethyl depend on the context and formulation in which it is employed, meaning that its application and efficacy may vary based on the specific conditions and methods of administration.
Check Digit Verification of cas no
The CAS Registry Mumber 89856-17-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,8,5 and 6 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 89856-17:
(7*8)+(6*9)+(5*8)+(4*5)+(3*6)+(2*1)+(1*7)=197
197 % 10 = 7
So 89856-17-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H15N3O/c1-8-7(11)10-5-3-9(2)4-6-10/h3-6H2,1-2H3,(H,8,11)
