898778-07-9 Usage
Structure
A thiophene derivative containing a bromobenzoyl group and a dioxolan-2-yl group.
Potential applications
Organic synthesis, medicinal chemistry, and material science.
Bromobenzoyl group
Can participate in various chemical reactions.
Dioxolan-2-yl group
Provides additional functionality for specific applications.
Versatility
Has potential uses in a variety of chemical and pharmaceutical contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 898778-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898778-07:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*8)+(2*0)+(1*7)=269
269 % 10 = 9
So 898778-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H11BrO3S/c15-10-3-1-9(2-4-10)13(16)11-5-6-12(19-11)14-17-7-8-18-14/h1-6,14H,7-8H2