90005-55-3 Usage
Description
3'-Amino-2'-hydroxyacetophenone hydrochloride is an organic compound characterized by its light brown solid appearance. It is a derivative of acetophenone, featuring an amino group at the 3' position and a hydroxy group at the 2' position, with a hydrochloride counterion. 3'-Amino-2'-hydroxyacetophenone hydrochloride is known for its potential applications in chemical synthesis and pharmaceutical industries.
Uses
Used in Chemical Synthesis:
3'-Amino-2'-hydroxyacetophenone hydrochloride is used as a reagent for the preparation of Aminophenol derivatives. Its unique structure allows it to serve as a key intermediate in the synthesis of various organic compounds, contributing to the development of new chemical entities with potential applications in different fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3'-Amino-2'-hydroxyacetophenone hydrochloride is utilized as a building block for the synthesis of pharmaceutical compounds. Its presence in the molecular structure can impart specific properties to the final product, such as improved solubility, stability, or biological activity, making it a valuable component in drug development processes.
Used in Research and Development:
3'-Amino-2'-hydroxyacetophenone hydrochloride is also employed in research and development settings, where it can be used to explore the chemical properties and reactivity of similar compounds. This knowledge can be applied to optimize synthetic routes, develop new methodologies, or discover novel applications for related compounds.
Preparation
Preparation by catalytic hydrogenolysis of 3-amino-5-chloro-2-hydroxyacetophenone hydrochloride at 25° in the presence of Pd/C in isopropanol (94%).
Check Digit Verification of cas no
The CAS Registry Mumber 90005-55-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,0 and 5 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 90005-55:
(7*9)+(6*0)+(5*0)+(4*0)+(3*5)+(2*5)+(1*5)=93
93 % 10 = 3
So 90005-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2.ClH/c1-5(10)6-3-2-4-7(9)8(6)11;/h2-4,11H,9H2,1H3;1H
