90057-09-3 Usage
Description
2,6-Dimethoxy-7-deazapurine, with the chemical formula C6H8N4O2, is a white crystalline solid that serves as a valuable intermediate in organic synthesis. Its unique structure, featuring two methoxy groups and a 7-deazapurine core, makes it a versatile building block for the development of various chemical compounds and pharmaceutical agents.
Uses
Used in Organic Synthesis:
2,6-Dimethoxy-7-deazapurine is used as a synthetic intermediate for the preparation of a wide range of organic compounds. Its reactivity and functional groups allow chemists to modify and incorporate it into more complex molecules, facilitating the synthesis of novel compounds with potential applications in various fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,6-Dimethoxy-7-deazapurine is used as a key component in the development of new drugs. Its unique structure and properties make it a promising candidate for the design of innovative therapeutic agents, particularly in the areas of antiviral, anticancer, and anti-inflammatory treatments. Researchers can exploit its chemical properties to create new molecules with improved pharmacological profiles and therapeutic effects.
Used in Chemical Research:
2,6-Dimethoxy-7-deazapurine also plays a significant role in chemical research, where it is employed as a model compound to study various chemical reactions and mechanisms. Its unique structure allows researchers to gain insights into the reactivity and behavior of similar compounds, contributing to the advancement of organic chemistry and the discovery of new synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 90057-09-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,5 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 90057-09:
(7*9)+(6*0)+(5*0)+(4*5)+(3*7)+(2*0)+(1*9)=113
113 % 10 = 3
So 90057-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3O2/c1-12-7-5-3-4-9-6(5)10-8(11-7)13-2/h3-4H,1-2H3,(H,9,10,11)
90057-09-3Relevant articles and documents
Condensed heteroaromatic ring systems. XXI. Synthesis of pyrrolo[2,3-d]pyrimidines and pyrrolo[3,2-d]pyrimidines
Sakamoto,Satoh,Kondo,Yamanaka
, p. 81 - 86 (2007/10/02)
Pyrrolo[2,3-d]pyrimidines and pyrrolo[3,2-d]pyrimidines were synthesized in high yields by the palladium-catalyzed reaction of 4-acetylamino-5-bromopyrimidines and 5-acetylamino-4-iodopyrimidines with (Z)-1-ethoxy-2-(tributylstannyl)ethene followed by cyclization under acidic conditions.
ara-7-Desazaxanthosine: A xanthine nucleoside with a stabile N- glycosylic bond
Seela,Liman
, p. 273 - 282 (2007/10/02)
-
