90109-16-3 Usage
Chemical class
It belongs to the class of dibenzo[c,e]azepine derivatives.
Molecular structure
1,2-Ddpatc is a tricyclic molecule with a unique seven-membered ring structure.
Pharmacological properties
It has been studied for its potential as a ligand for the serotonin receptors in the brain.
Therapeutic applications
Research on 1,2-Ddpatc has investigated its potential in the development of new therapeutic agents for various neurological and psychiatric disorders.
Field of study
The compound's structure and activity are being explored in the field of medicinal chemistry and neuroscience.
Ongoing research
The potential applications of 1,2-Ddpatc in the field of medicinal chemistry and neuroscience are still being investigated.
Check Digit Verification of cas no
The CAS Registry Mumber 90109-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,1,0 and 9 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 90109-16:
(7*9)+(6*0)+(5*1)+(4*0)+(3*9)+(2*1)+(1*6)=103
103 % 10 = 3
So 90109-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H23NO2/c1-2-8-15-11-4-3-5-12-10(9-11)6-7-13(16)14(12)17/h7,10-11,15-17H,2-6,8-9H2,1H3