90203-05-7 Usage
General Description
N,N-DIMETHYL-3-PIPERIDINEMETHANAMINE is a chemical compound with the molecular formula C9H20N2. It is a tertiary amine that is commonly used as a reagent in organic synthesis, particularly in the manufacture of pharmaceuticals and agrochemicals. N,N-DIMETHYL-3-PIPERIDINEMETHANAMINE is also utilized as a catalyst in various chemical reactions, such as the formation of carbon-carbon bonds. Additionally, it is known for its role as an intermediate in the synthesis of other organic compounds, such as quaternary ammonium salts. N,N-DIMETHYL-3-PIPERIDINEMETHANAMINE is a versatile and valuable chemical that finds numerous applications in the field of chemical research and production.
Check Digit Verification of cas no
The CAS Registry Mumber 90203-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,2,0 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 90203-05:
(7*9)+(6*0)+(5*2)+(4*0)+(3*3)+(2*0)+(1*5)=87
87 % 10 = 7
So 90203-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H18N2/c1-10(2)7-8-4-3-5-9-6-8/h8-9H,3-7H2,1-2H3
