902836-71-9 Usage
General Description
2-Fluoro-N-methyl-6-phenoxybenzylamine hydrochloride, or 6-FPB hydrochloride, is a chemical compound, specifically a fluorinated benzylamine derivative. Its structure includes a phenyl ring substituted with a phenoxy group at the 6-position and a fluorine atom at the 2-position. Furthermore, it has a N-methyl group attached to the benzylamine part of the molecule. However, as the chemical's properties, uses, hazards, or potential applications are not widely mentioned in scientific literature, the specific information remains scarce. The compound could potentially be used in chemical or pharmaceutical research, although more specific information would require further investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 902836-71-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 6 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 902836-71:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*6)+(2*7)+(1*1)=169
169 % 10 = 9
So 902836-71-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H14FNO.ClH/c1-16-10-12-13(15)8-5-9-14(12)17-11-6-3-2-4-7-11;/h2-9,16H,10H2,1H3;1H
