903130-08-5 Usage
General Description
3-Bromo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine hydrochloride is a chemical compound with a specific structure denoted by its name, which indicates the presence of a bromine atom, a triazolo[4,3-a]pyrazine ring, and four hydrogen atoms. Its hydrochloride form suggests that it has been combined with a hydrochloric acid, which typically makes the compound soluble in water and easily handled. As with any chemical compound, its properties such as reactiveness, toxicity, and usage would depend on the specific arrangements of these parts and would be determined through laboratory testing. As of now, detailed information about its properties and potential applications is not widely available.
Check Digit Verification of cas no
The CAS Registry Mumber 903130-08-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,3,1,3 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 903130-08:
(8*9)+(7*0)+(6*3)+(5*1)+(4*3)+(3*0)+(2*0)+(1*8)=115
115 % 10 = 5
So 903130-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H7BrN4/c6-5-9-8-4-3-7-1-2-10(4)5/h7H,1-3H2
903130-08-5Relevant articles and documents
New tetrahydropyrido pyrimidinecarboxylic compound or salt thereof
-
, (2016/10/08)
To provide a compound having an inhibitory activity for an androgen receptor. A tetrahydropyridopyrimidine compound represented by the following general formula (I) or a pharmaceutically acceptable thereof (in the formula, X and R are as defined in the specification).
