906352-98-5 Usage
Description
3-[(6-Methylpyrazin-2-yl)oxy]benzyl alcohol is a chemical compound with the molecular formula C13H14N2O2. It is a white crystalline solid that features a benzyl alcohol group attached to a pyrazine ring, giving it unique properties and potential applications in various fields.
Used in Organic Synthesis:
3-[(6-Methylpyrazin-2-yl)oxy]benzyl alcohol is used as a building block for the synthesis of other organic compounds, contributing to the development of new chemical entities and materials.
Used in Medicinal Chemistry:
3-[(6-Methylpyrazin-2-yl)oxy]benzyl alcohol is used as a starting material or intermediate in the design and synthesis of pharmaceutical compounds, potentially leading to the discovery of new drugs with therapeutic benefits.
Used in Pharmaceutical Industry:
3-[(6-Methylpyrazin-2-yl)oxy]benzyl alcohol is being studied for its potential pharmacological properties, which may lead to its application in the development of new medications for various diseases and conditions.
Used in Materials Science:
3-[(6-Methylpyrazin-2-yl)oxy]benzyl alcohol is used in the research and development of new materials with specific properties, such as improved stability, reactivity, or selectivity, for applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 906352-98-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,6,3,5 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 906352-98:
(8*9)+(7*0)+(6*6)+(5*3)+(4*5)+(3*2)+(2*9)+(1*8)=175
175 % 10 = 5
So 906352-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O2/c1-9-6-13-7-12(14-9)16-11-4-2-3-10(5-11)8-15/h2-7,15H,8H2,1H3
