912569-69-8 Usage
Description
4-[4-(Chloromethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine is a synthetic compound that features a piperidine ring and a thieno[3,2-d]pyrimidine ring. The incorporation of a chloromethyl group on the piperidine ring endows the compound with the potential to inhibit specific biological processes, making it a candidate for further exploration in medicinal chemistry.
Uses
Used in Medicinal Chemistry:
4-[4-(Chloromethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine is used as a potential inhibitor for the development of drugs targeting various diseases. Its unique structure and functional groups may allow it to interact with biological systems in ways that could be harnessed for therapeutic purposes.
Further research and exploration of 4-[4-(Chloromethyl)piperidin-1-yl]thieno[3,2-d]pyrimidine's properties and potential biological activities are essential to uncover its full range of applications and to determine its suitability for specific medicinal uses.
Check Digit Verification of cas no
The CAS Registry Mumber 912569-69-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,2,5,6 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 912569-69:
(8*9)+(7*1)+(6*2)+(5*5)+(4*6)+(3*9)+(2*6)+(1*9)=188
188 % 10 = 8
So 912569-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H14ClN3S/c13-7-9-1-4-16(5-2-9)12-11-10(3-6-17-11)14-8-15-12/h3,6,8-9H,1-2,4-5,7H2