913835-39-9 Usage
General Description
4-(2-chloro-4-methylphenylcarbamoyl)phenylboronic acid is a chemical compound with the molecular formula C14H13BClNO3. 4-(2-CHLORO-4-METHYLPHENYLCARBAMOYL)PHENYLBORONIC ACID is a boronic acid derivative and contains a phenylboronic acid group and a carbamoyl group. It is commonly used in organic synthesis as a reagent for the preparation of various pharmaceuticals, agrochemicals, and materials. It is also used in the development of new chemical reactions and methodologies for the formation of carbon-carbon and carbon-heteroatom bonds. Additionally, it has potential applications in the field of medicinal chemistry for the development of new drugs and drug delivery systems.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-39-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 913835-39:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*3)+(1*9)=179
179 % 10 = 9
So 913835-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BClNO3/c1-9-2-7-13(12(16)8-9)17-14(18)10-3-5-11(6-4-10)15(19)20/h2-8,19-20H,1H3,(H,17,18)
