914347-82-3 Usage
General Description
5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine is a chemical compound that contains a pyrimidine ring with a bromine atom at the 5-position and a pyrrolidin-3-yloxy group attached to the 2-position. It is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 5-BROMO-2-(PYRROLIDIN-3-YLOXY)PYRIMIDINE has potential applications in medicinal chemistry, particularly in the development of new drugs for various diseases. Its unique structure and reactivity make it a valuable building block for the production of diverse bioactive molecules. Additionally, its properties make it suitable for use in research and development of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 914347-82-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,4,3,4 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 914347-82:
(8*9)+(7*1)+(6*4)+(5*3)+(4*4)+(3*7)+(2*8)+(1*2)=173
173 % 10 = 3
So 914347-82-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BrN3O/c9-6-3-11-8(12-4-6)13-7-1-2-10-5-7/h3-4,7,10H,1-2,5H2