91562-48-0 Usage
General Description
1-(5,6,7,8-Tetrahydronaphthalen-2-yl)ethanamine, also known as "tetralinylamine," is a chemical compound with a molecular structure consisting of a naphthalene ring system and an ethanamine functional group. It is commonly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and organic compounds. Tetralinylamine has a range of potential applications in the fields of medicine, industry, and research, due to its unique chemical properties and reactivity. Its cyclic structure and amine group make it a versatile precursor for the creation of new molecules with a variety of biological and chemical properties. Additionally, it has shown potential as a potential candidate for the development of new drug therapies and other valuable compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 91562-48-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,5,6 and 2 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 91562-48:
(7*9)+(6*1)+(5*5)+(4*6)+(3*2)+(2*4)+(1*8)=140
140 % 10 = 0
So 91562-48-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h6-9H,2-5,13H2,1H3/p+1/t9-/m1/s1
91562-48-0Relevant articles and documents
AMIDE COMPOUND AND METHOD OF CONTROLLING PLANT DISEASE WITH THE SAME
-
Page/Page column 107, (2010/02/14)
A amid compound of the formula (1): wherein, in the formula, R51 represents a halogen atom, a C1-C6 alkyl group and the like; R52 represents a hydrogen atom, a halogen atom, a C1-C6 alkyl group and the like; R53 represents a halogen atom and the like; R56 represents a halogen atom and the like; R57 represents a hydrogen atom and the like; R58 and R59 independently represent a hydrogen atom, a C1-C3 alkyl group and the like; R60 represents a C1-C4 alkyl group, a C1-C4 haloalkyl group, a C3-C4 alkenyl group, or a C3-C6 alkynyl group; R61 represents a C1-C4 alkyl group, a C1-C4 haloalkyl group, a C3-C4 alkenyl group or a C3-C6 alkynyl group or a C2-C4 cyanoalkyl group; R62, R63 and R64 represent a hydrogen atom, a halogen atom and the like; X represents a oxygen atom or a sulfur atom; has an excellent activity against plant diseases.
