92135-04-1 Usage
Description
mono-5-methylhexylphthalate, a branched Phthalate ester, is an intermediate in the synthesis of dialkyl phthalates. It possesses unique properties that make it suitable for various applications, particularly as plasticizers and additives.
Uses
Used in Plastic Industry:
mono-5-methylhexylphthalate is used as a plasticizer for enhancing the flexibility, workability, and durability of various types of plastics. Its incorporation into plastic materials allows for improved performance and a wider range of applications.
Used in Additive Industry:
As an additive, mono-5-methylhexylphthalate plays a crucial role in improving the overall quality and characteristics of different products. It can be incorporated into various formulations to achieve desired properties, such as increased stability, enhanced performance, or specific functional attributes.
Check Digit Verification of cas no
The CAS Registry Mumber 92135-04-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,1,3 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 92135-04:
(7*9)+(6*2)+(5*1)+(4*3)+(3*5)+(2*0)+(1*4)=111
111 % 10 = 1
So 92135-04-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H20O4/c1-11(2)7-5-6-10-19-15(18)13-9-4-3-8-12(13)14(16)17/h3-4,8-9,11H,5-7,10H2,1-2H3,(H,16,17)