927186-53-6 Usage
General Description
2-Pyridinamine, 5-iodo-3-nitro-6-[2-(4-nitrophenyl)ethoxy]- is a complex chemical compound with a 2-pyridinamine base and additional iodine, nitro, and ethoxy groups. The presence of these groupings gives the compound distinct properties, including a potentially high toxicity due to the presence of the nitro and iodine moieties. The compound also consists of a 2-(4-nitrophenyl)ethoxy group, which may contribute to its potential applications in pharmaceutical or organic synthesis. Overall, the compound exhibits a complex structure with various functional groups, suggesting potential use in diverse applications within the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 927186-53-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,2,7,1,8 and 6 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 927186-53:
(8*9)+(7*2)+(6*7)+(5*1)+(4*8)+(3*6)+(2*5)+(1*3)=196
196 % 10 = 6
So 927186-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H11IN4O5/c14-10-7-11(18(21)22)12(15)16-13(10)23-6-5-8-1-3-9(4-2-8)17(19)20/h1-4,7H,5-6H2,(H2,15,16)
