92992-17-1 Usage
General Description
7-(methoxycarbonyl)-6,7-dihydro-5-H-pyrrolizine-1-carboxylic acid is a chemical compound with an intricate structure, consisting of a pyrrolizine ring fused to a carboxylic acid side chain. It is a heterocyclic compound with potential pharmaceutical applications, possibly in the field of medicinal chemistry as a building block in organic synthesis. The methoxycarbonyl functional group adds a specific chemical property to the molecule, allowing for potential reactivity and interactions with other compounds. Overall, this compound has potential for various applications in the field of chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 92992-17-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,9,9 and 2 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 92992-17:
(7*9)+(6*2)+(5*9)+(4*9)+(3*2)+(2*1)+(1*7)=171
171 % 10 = 1
So 92992-17-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO4/c1-15-10(14)7-3-5-11-4-2-6(8(7)11)9(12)13/h2,4,7H,3,5H2,1H3,(H,12,13)