93015-58-8 Usage
Description
6-BENZOYL-3,4-DIMETHYL-3-CYCLOHEXENE-1-CARBOXYLIC ACID, also known as benzoylphenylalanine, is a chemical compound that features a benzoyl group, a cyclohexene ring, and a carboxylic acid group. It is recognized for its role as a chiral building block in the synthesis of pharmaceuticals and organic compounds. 6-BENZOYL-3,4-DIMETHYL-3-CYCLOHEXENE-1-CARBOXYLIC ACID has also demonstrated anti-inflammatory and antioxidant properties, making it a subject of interest in medical research. Furthermore, it contributes to the production of advanced materials and serves as a reagent in various organic reactions.
Uses
Used in Pharmaceutical Synthesis:
6-BENZOYL-3,4-DIMETHYL-3-CYCLOHEXENE-1-CARBOXYLIC ACID is used as a chiral building block for the development of pharmaceuticals and organic compounds. Its unique structure allows for the creation of enantiomerically pure molecules, which is crucial in the production of effective and safe drugs.
Used in Medical Research:
In the field of medical research, 6-BENZOYL-3,4-DIMETHYL-3-CYCLOHEXENE-1-CARBOXYLIC ACID is utilized for its potential anti-inflammatory and antioxidant properties. These characteristics make it a valuable compound for studying and potentially treating various diseases and conditions where inflammation and oxidative stress play a role.
Used in Advanced Material Production:
6-BENZOYL-3,4-DIMETHYL-3-CYCLOHEXENE-1-CARBOXYLIC ACID is used in the production of advanced materials due to its chemical properties and reactivity. Its involvement in material science contributes to the development of new materials with improved properties for various applications.
Used as a Reagent in Organic Reactions:
As a reagent, 6-BENZOYL-3,4-DIMETHYL-3-CYCLOHEXENE-1-CARBOXYLIC ACID is employed in a range of organic reactions to facilitate the synthesis of complex organic molecules. Its versatility in these reactions is an asset to chemists working on the development of new chemical entities and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 93015-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,0,1 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 93015-58:
(7*9)+(6*3)+(5*0)+(4*1)+(3*5)+(2*5)+(1*8)=118
118 % 10 = 8
So 93015-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H18O3/c1-10-8-13(14(16(18)19)9-11(10)2)15(17)12-6-4-3-5-7-12/h3-7,13-14H,8-9H2,1-2H3,(H,18,19)